| Company Name: |
Puripharm Co., Ltd. |
| Tel: |
0572-2745768-1 13167223168;13167223168 |
| Email: |
sales@puripharm.com |
|
| | 2-[[(2E)-3-(4-Hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]benzoic acid Basic information |
| | 2-[[(2E)-3-(4-Hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]benzoic acid Chemical Properties |
| Melting point | 220 °C(Solv: water (7732-18-5); acetone (67-64-1)) | | Boiling point | 578.1±50.0 °C(Predicted) | | density | 1.400±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.47±0.36(Predicted) | | InChI | 1S/C16H13NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-10,18H,(H,17,19)(H,20,21)/b10-7+ | | InChIKey | INBHLTYBRKASIZ-JXMROGBWSA-N | | SMILES | N(c2c(cccc2)C(=O)O)C(=O)\C=C\c1ccc(cc1)O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT SE 3 |
| | 2-[[(2E)-3-(4-Hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]benzoic acid Usage And Synthesis |
| Definition | ChEBI: Avenanthramide 1p is a member of benzamides and an alkaloid. |
| | 2-[[(2E)-3-(4-Hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]benzoic acid Preparation Products And Raw materials |
|