| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Thiocholesterol manufacturers
- Thiocholesterol
-
-
2025-12-24
- CAS:1249-81-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KG
|
| | Thiocholesterol Basic information |
| Product Name: | Thiocholesterol | | Synonyms: | 5-CHOLESTEN-3ALPHA-THIOL;cholest-5-ene-3beta-thiol;THIOCHOLESTEROL SEALED AMPULE;5-cholestene-3β-thiol;5-Cholestene-3β-thiol, Cholesteryl mercaptan;Cholest-5-ene-3β-thiol;Cholesteryl mercaptan;Cholest-5-ene-3b-thiol | | CAS: | 1249-81-6 | | MF: | C27H46S | | MW: | 402.72 | | EINECS: | 215-003-4 | | Product Categories: | | | Mol File: | 1249-81-6.mol |  |
| | Thiocholesterol Chemical Properties |
| Melting point | 97-99 °C (lit.) | | Boiling point | 482.4±24.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | pka | 10.71±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D 23°, c = 1 in chloroform | | Stability: | Air Sensitive | | InChIKey | QGVQZRDQPDLHHV-DPAQBDIFSA-N | | SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](S)CC[C@]4(C)[C@H]3CC[C@]12C | | LogP | 11.330 (est) | | EPA Substance Registry System | Cholest-5-ene-3-thiol, (3.beta.)- (1249-81-6) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Thiocholesterol Usage And Synthesis |
| Uses | Thiocholesterol is a compound used in biological cross-linking and membrane studies. | | General Description | Thiocholesterol is a lipid similar to cholesterol except that the hydroxyl group is replaced with thiol group. |
| | Thiocholesterol Preparation Products And Raw materials |
|