2-CHLOROBUTYRYL CHLORIDE manufacturers
|
| | 2-CHLOROBUTYRYL CHLORIDE Basic information |
| Product Name: | 2-CHLOROBUTYRYL CHLORIDE | | Synonyms: | 2-Chlorobutyryl chloride, tech. 85%;2-CHLOROBUTYRYL CHLORIDE;Butanoyl chloride, 2-chloro-;2-CHLOROBUTYRYL CHLORIDE ISO 9001:2015 REACH;2 - chlorobutanoyl chloride | | CAS: | 7623-11-2 | | MF: | C4H6Cl2O | | MW: | 141 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 7623-11-2.mol |  |
| | 2-CHLOROBUTYRYL CHLORIDE Chemical Properties |
| Boiling point | 138-140°C | | density | 1,236 g/cm3 | | refractive index | 1.4510 | | Fp | 138-140°C | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 741947 | | InChI | InChI=1S/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 | | InChIKey | KVQJVAOMYWTLEO-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C(Cl)CC |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | HazardClass | 8 | | PackingGroup | II |
| Provider | Language |
|
ALFA
| English |
| | 2-CHLOROBUTYRYL CHLORIDE Usage And Synthesis |
| Uses | 2-Chlorobutyryl chloride is used as a pharmaceutical intermediate. |
| | 2-CHLOROBUTYRYL CHLORIDE Preparation Products And Raw materials |
|