| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(tert-Butoxycarbonylamino)-4-chlorophenylboronic acid Basic information |
| Product Name: | 3-(tert-Butoxycarbonylamino)-4-chlorophenylboronic acid | | Synonyms: | 3-AMINO-4-CHLOROBENZENEBORONIC ACID, N-BOC PROTECTED;3-BOC-AMINO-4-CHLOROPHENYLBORONIC ACID;3-(tert-Butoxycarbonylamino)-4-chlorobenzeneboronic acid;3-Amino-4-chlorobenzeneboronic acid, N-BOC protected 97%;3-(t-Butoxycarbonylamino)-4-chlorophenylboronic acid;3-(Boc-aMino)-4-chlorobenzeneboronic acid, 97%;N-BOC-3-AMINO-4-CHLOROBENZENEBORONIC ACID;Carbamic acid, N-(5-borono-2-chlorophenyl)-, C-(1,1-dimethylethyl) ester | | CAS: | 871329-57-6 | | MF: | C11H15BClNO4 | | MW: | 271.51 | | EINECS: | | | Product Categories: | Amines;blocks;BoronicAcids | | Mol File: | 871329-57-6.mol |  |
| | 3-(tert-Butoxycarbonylamino)-4-chlorophenylboronic acid Chemical Properties |
| Melting point | 180-182 | | storage temp. | Sealed in dry,2-8°C |
| Hazard Codes | Xi | | Hazard Note | Irritant/ Keep Cold | | HS Code | 2931900090 |
| | 3-(tert-Butoxycarbonylamino)-4-chlorophenylboronic acid Usage And Synthesis |
| | 3-(tert-Butoxycarbonylamino)-4-chlorophenylboronic acid Preparation Products And Raw materials |
|