|
|
| | (3-BOC-AMINOPHENYL)BORONIC ACID Basic information |
| | (3-BOC-AMINOPHENYL)BORONIC ACID Chemical Properties |
| Melting point | 160-170°C | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.23±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C11H16BNO4/c1-11(2,3)17-10(14)7-5-4-6-8(9(7)13)12(15)16/h4-6,15-16H,13H2,1-3H3 | | InChIKey | HZVJBIHDNGATSA-UHFFFAOYSA-N | | SMILES | C1(B(O)O)=CC=CC(C(OC(C)(C)C)=O)=C1N | | CAS DataBase Reference | 380430-68-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | (3-BOC-AMINOPHENYL)BORONIC ACID Usage And Synthesis |
| Uses | Reactant for:
- Rhodium-catalyzed cross-coupling
- Pd-catalyzed Suzuki-Miyaura coupling
|
| | (3-BOC-AMINOPHENYL)BORONIC ACID Preparation Products And Raw materials |
|