| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S)-2-Carboxymethyl-piperidine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | (S)-2-Carboxymethyl-piperidine-1-carboxylic acid tert-butyl ester | | Synonyms: | 2-[(2S)-1-[(tert-butoxy)carbonyl]piperidin-2-yl]acetic acid;(S)-BOC-(2-CARBOXYMETHYL)-PIPERIDINE;(S)-(1-BOC-PIPERIDIN-2-YL)-ACETIC ACID;(S)-N-Boc-2-carboxymethyl-piperidine;(S)-N-Boc-2-piperidine acetic acid;(S)-1-Boc-piperidin-2-ylacetic acid, (S)-N-Boc-2-carboxymethyl-piperidine;2-((S)-1-(tert-butoxycarbonyl)piperidin-2-yl)acetic acid;(S)-1-Boc-2-piperidineacetic acid >=99.0% (HPLC) | | CAS: | 159898-10-9 | | MF: | C12H21NO4 | | MW: | 243.3 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 159898-10-9.mol |  |
| | (S)-2-Carboxymethyl-piperidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Melting point | 93-97°C | | storage temp. | 2-8°C | | Appearance | Off-white to light yellow Solid | | Optical Rotation | [α]/D -12.0±2°, c = 1.5 in methanol | | InChI | 1S/C12H21NO4/c1-12(2,3)17-11(16)13-7-5-4-6-9(13)8-10(14)15/h9H,4-8H2,1-3H3,(H,14,15)/t9-/m0/s1 | | InChIKey | CKAXJDBTNNEENW-VIFPVBQESA-N | | SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CC(O)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | (S)-2-Carboxymethyl-piperidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder |
| | (S)-2-Carboxymethyl-piperidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|