|
|
| | 3-Acetyl-1-(phenylsulfonyl)pyrrole Basic information |
| | 3-Acetyl-1-(phenylsulfonyl)pyrrole Chemical Properties |
| Melting point | 96-99 °C(lit.) | | Boiling point | 435.7±37.0 °C(Predicted) | | density | 1.3164 (rough estimate) | | refractive index | 1.6000 (estimate) | | pka | -11.54±0.70(Predicted) | | form | Solid | | InChI | 1S/C12H11NO3S/c1-10(14)11-7-8-13(9-11)17(15,16)12-5-3-2-4-6-12/h2-9H,1H3 | | InChIKey | HTMLKRFQINMFRA-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccn(c1)S(=O)(=O)c2ccccc2 | | CAS DataBase Reference | 81453-98-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Acetyl-1-(phenylsulfonyl)pyrrole Usage And Synthesis |
| Chemical Properties | BEIGE CRYSTALLINE POWDER | | Uses | 3-Acetyl-1-(phenylsulfonyl)pyrrole is a heterocyclic building block. | | Definition | ChEBI: 1-[1-(benzenesulfonyl)-3-pyrrolyl]ethanone is a sulfonamide. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 48, p. 3214, 1983 DOI: 10.1021/jo00167a014 | | General Description | 3-Acetyl-1-(phenylsulfonyl)pyrrole is a heterocyclic building block. |
| | 3-Acetyl-1-(phenylsulfonyl)pyrrole Preparation Products And Raw materials |
|