|
|
| | 1,3-Bis(2-hydroxyethoxy)benzene Basic information |
| Product Name: | 1,3-Bis(2-hydroxyethoxy)benzene | | Synonyms: | 1,3-DI(2-HYDROXYETHOXY)BENZENE;1,3-BIS(2-HYDROXYETHOXY)BENZENE;RESORCINOL BIS-(2-HYDROXYETHYL)ETHER;RESORCINOL BIS(BETA-HYDROXYETHYL) ETHER;RESORCINOL DIHYDROXYETHYL ETHER;2,2’-[1,3-phenylenebis(oxy)]bis-ethano;O,O'-Bis(2'-hydroxyethyl) resorcinol;Bishydroxyethoxybenzene | | CAS: | 102-40-9 | | MF: | C10H14O4 | | MW: | 198.22 | | EINECS: | 203-028-3 | | Product Categories: | Aromatic Ethers | | Mol File: | 102-40-9.mol |  |
| | 1,3-Bis(2-hydroxyethoxy)benzene Chemical Properties |
| Melting point | 90 °C | | Boiling point | 234 °C / 30mmHg | | density | 1+-.0.06 g/cm3(Predicted) | | vapor pressure | 4.5Pa at 20℃ | | solubility | Slightly soluble in water | | pka | 13.95±0.10(Predicted) | | form | powder to lump | | color | White to Almost white | | Water Solubility | 18g/L at 20℃ | | InChI | InChI=1S/C10H14O4/c11-4-6-13-9-2-1-3-10(8-9)14-7-5-12/h1-3,8,11-12H,4-7H2 | | InChIKey | IAXFZZHBFXRZMT-UHFFFAOYSA-N | | SMILES | C1(OCCO)=CC=CC(OCCO)=C1 | | LogP | 0.26 at 20℃ | | CAS DataBase Reference | 102-40-9(CAS DataBase Reference) | | EPA Substance Registry System | Ethanol, 2,2'-[1,3-phenylenebis(oxy)]bis- (102-40-9) |
| TSCA | TSCA listed | | HS Code | 2909.49.6000 |
| | 1,3-Bis(2-hydroxyethoxy)benzene Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 1,3-Bis(2-hydroxyethoxy)benzene Preparation Products And Raw materials |
| Raw materials | Acetic acid, 2,2'-[1,3-phenylenebis(oxy)]bis-, diethyl ester-->2-Chloroethanol-->Resorcinol-->Ethylene glycol | | Preparation Products | Benzo[1,2-b:5,4-b']difuran, 2,3,5,6-tetrahydro- |
|