|
|
| | 1,3-Propanediol-d8 Basic information |
| | 1,3-Propanediol-d8 Chemical Properties |
| Melting point | -27 °C(lit.) | | Boiling point | 214 °C(lit.) | | density | 1.162 g/mL at 25 °C | | Fp | 93 °C | | InChI | 1S/C3H8O2/c4-2-1-3-5/h4-5H,1-3H2/i1D2,2D2,3D2,4D,5D | | InChIKey | YPFDHNVEDLHUCE-JVKIUYSHSA-N | | SMILES | [2H]OC([2H])([2H])C([2H])([2H])C([2H])([2H])O[2H] |
| WGK Germany | WGK 1 | | Storage Class | 10 - Combustible liquids |
| | 1,3-Propanediol-d8 Usage And Synthesis |
| Uses | 1,3-Propanediol-d8 is the labelled version of 1,3-Propanediol (P760320), which is a common organic reagent used in the synthesis of polymers and used in industrial organic chemistry for the synthesis of lubricants, foods, medicines and cosmetics. |
| | 1,3-Propanediol-d8 Preparation Products And Raw materials |
|