| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,2'-Bis[(4S)-4-benzyl-2-oxazoline] Basic information |
| Product Name: | 2,2'-Bis[(4S)-4-benzyl-2-oxazoline] | | Synonyms: | (4S,4'S)- 4,4',5,5'-tetrahydro-4,4'-bis(phenylmethyl)-2,2'-Bioxazole;(S,S)-4,4'-dibenzyl-2,2'-bi(2-oxazoline);(s,s)-2,2'-bis(4-benzyl-2-oxazoline);(S,S)-2,2μ-Bis(4-benzyl-2-oxazoline), (S,S)-4,4μ-Dibenzyl-2,2μ-bi(2-oxazoline);2,2′-Bis[(4S)-4-benzyl-2-oxazoline],(S,S)-2,2′-Bis(4-benzyl-2-oxazoline), (S,S)-4,4′-Dibenzyl-2,2′-bi(2-oxazoline);(4S,4'S)-4,4'-dibenzyl-4,4',5,5'-tetrahydro-2,2'-bioxazole;SF140046;2,2'-Bioxazole, 4,4',5,5'-tetrahydro-4,4'-bis(phenylmethyl)-, (4S,4'S)- | | CAS: | 133463-88-4 | | MF: | C20H20N2O2 | | MW: | 320.39 | | EINECS: | | | Product Categories: | | | Mol File: | 133463-88-4.mol | ![2,2'-Bis[(4S)-4-benzyl-2-oxazoline] Structure](CAS/GIF/133463-88-4.gif) |
| | 2,2'-Bis[(4S)-4-benzyl-2-oxazoline] Chemical Properties |
| Melting point | 129-132 °C(lit.) | | Boiling point | 449.3±28.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 3.89±0.70(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 40.6°, c = 1 in ethanol | | BRN | 4756827 | | InChI | 1S/C20H20N2O2/c1-3-7-15(8-4-1)11-17-13-23-19(21-17)20-22-18(14-24-20)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m0/s1 | | InChIKey | OIEQQWQZUYZCRJ-ROUUACIJSA-N | | SMILES | C1OC(=N[C@H]1Cc2ccccc2)C3=N[C@H](CO3)Cc4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2'-Bis[(4S)-4-benzyl-2-oxazoline] Usage And Synthesis |
| Uses | 2,2′-Bis[(4S)-4-benzyl-2-oxazoline] can be used as:
- A catalyst for the enantioselective hydrosilylation of ketones.
- A Schiff base ligand in the preparation of rhodium(I) and palladium(II) coordination complexes.
- A ligand in the formation of copper(I) halide complexes; applicable in the synthesis of coordination polymers.
|
| | 2,2'-Bis[(4S)-4-benzyl-2-oxazoline] Preparation Products And Raw materials |
|