| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
DABSYL CHLORIDE manufacturers
- Dabsyl chloride
-
- $38.00
-
2026-07-30
- CAS:56512-49-3
- Purity: ≥98%
- Supply Ability: 10g
|
| | DABSYL CHLORIDE Basic information |
| Product Name: | DABSYL CHLORIDE | | Synonyms: | DABSYL CHLORIDE;4-((4-(dimethylamino)phenyl)azo)-benzenesulfonylchlorid;4-[[4-(dimethylamino)phenyl]azo]-benzenesulfonylchlorid;4-n,n-dimethylaminoazobenzene-4’-sulfonylchloride;p-((p-(dimethylamino)phenyl)azo)-benzenesulfonylchlorid;4-DIMETHYLAMINOAZOBENZENE-4'-SULPHONYL CHLORIDE;4-DIMETHYLAMINOAZOBENZENE-4-SULPHONYL CHLORIDE;4-DIMETHYLAMINOAZOBENZENE-4-SULFONYL-CHLORIDE | | CAS: | 56512-49-3 | | MF: | C14H14ClN3O2S | | MW: | 323.8 | | EINECS: | 260-235-1 | | Product Categories: | marker | | Mol File: | 56512-49-3.mol |  |
| | DABSYL CHLORIDE Chemical Properties |
| Melting point | 185 °C (dec.) (lit.) | | Boiling point | 483.6±30.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMF: soluble | | form | powder to crystaline | | pka | 3.27±0.10(Predicted) | | color | Orange to Brown to Dark red | | Sensitive | Moisture Sensitive | | BRN | 3064095 | | InChI | 1S/C14H14ClN3O2S/c1-18(2)13-7-3-11(4-8-13)16-17-12-5-9-14(10-6-12)21(15,19)20/h3-10H,1-2H3/b17-16+ | | InChIKey | VTVWTPGLLAELLI-WUKNDPDISA-N | | SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)S(Cl)(=O)=O | | CAS DataBase Reference | 56512-49-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | DB8927800 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29270000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | DABSYL CHLORIDE Usage And Synthesis |
| Chemical Properties | Dark red crystalline | | Uses | For the qualitative and quantitative identification of amino acids and for the determination of N-terminal amino acids. Used in the determination of primary and secondary amines by HPLC. | | General Description | Amino groups are common to many biological compounds and many amines used in pharmaceuticals. Most of these compounds show weak absorption in direct HPLC analysis with UV-VIS detection. However, strongly absorbing derivatives of amines can be easily detected by HPLC with high sensitivity even when present at low concentrations. Primary and secondary amino groups are usually derivatized as aromatic derivatives by nucleophilic substitution reactions using reagents such as arylsulfonyl chlorides. 4-(Dimethylamino)azobenzene-4′-sulfonyl chloride, a well-known UV-labeling agent, is generally used for the derivatization of N-terminal amino acids, imidazole derivatives, polyamines, etc. prior to their chromatographic determination due to the former′s capacity to covalently bind to the substrates. Its derivatives typically absorb UV radiation between the range of 436-460 nm. This method of derivatization is regarded as superior compared to other methods owing to the simplicity of the procedure, high stability and reproducibility, best resolution of the analytes, etc. |
| | DABSYL CHLORIDE Preparation Products And Raw materials |
|