| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Boc-1,6-diamino-hexane hydrochloride Basic information |
| Product Name: | N-Boc-1,6-diamino-hexane hydrochloride | | Synonyms: | N-Boc-1,6-hexanediamine hydrochloride~N-tert-Butoxycarbonyl-1,6-diaminohexane hydrochloride~tert-Butyl N-(6-aminohexyl)carbamate hydrochloride;tert-butyl N-(6-aminohexyl)carbamate hydrochlorid;tert-butyl (6-aminohexyl)carbamate monohydrochloride;N-T-BOC-1,6-DIAMINOHEXANE HCL;N-T-BOC-HEXAMETHYLENDIAMINE HCL;N-T-BUTYLOXYCARBONYL-1,6-HEXAMETHYLENEDIAMINE HYDROCHLORIDE;N-TERT-BUTOXYCARBONYL-1,6-HEXANEDIAMINE HYDROCHLORIDE;N-TERT-BUTYLOXYCARBONYL-1,6-HEXAMETHYLENEDIAMINE HYDROCHLORIDE | | CAS: | 65915-94-8 | | MF: | C11H25ClN2O2 | | MW: | 252.78 | | EINECS: | 265-976-4 | | Product Categories: | Amino Acids | | Mol File: | 65915-94-8.mol |  |
| | N-Boc-1,6-diamino-hexane hydrochloride Chemical Properties |
| Melting point | 162-164 °C(lit.) | | storage temp. | 2-8°C | | form | Crystalline Powder | | color | White to cream | | Sensitive | Hygroscopic | | BRN | 3631740 | | InChI | 1S/C11H24N2O2.ClH/c1-11(2,3)15-10(14)13-9-7-5-4-6-8-12;/h4-9,12H2,1-3H3,(H,13,14);1H | | InChIKey | JSBWQIZQJOQPFN-UHFFFAOYSA-N | | SMILES | NCCCCCCNC(OC(C)(C)C)=O.[H]Cl | | CAS DataBase Reference | 65915-94-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29241900 | | Storage Class | 11 - Combustible Solids |
| | N-Boc-1,6-diamino-hexane hydrochloride Usage And Synthesis |
| Chemical Properties | White to cream colored crystalline powder | | Uses | Reagent for the introduction of a C6-spacer | | Uses | N-Boc-1,6-hexanediamine hydrochloride is a general reagent to introduce a C6-spacer. It can be used in:
- Synthesis of poly(L-glutamic acid) gadolinium chelates as biodegradable MRI contrast agents.
- Synthesis of cholesteryl-functionalized hyaluronic acid-based anionic nanogel for protein delivery.
- Preparation of amphiphilic prodrug, containing anticancer drug chlorambucil, which would self-assemble to form micelles in aqueous solution.
| | reaction suitability | reagent type: cross-linking reagent |
| | N-Boc-1,6-diamino-hexane hydrochloride Preparation Products And Raw materials |
|