| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,5-Dinitrophenyl isocyanate Basic information |
| | 3,5-Dinitrophenyl isocyanate Chemical Properties |
| Melting point | 82-87 °C(lit.) | | Boiling point | 338.6±32.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | 1S/C7H3N3O5/c11-4-8-5-1-6(9(12)13)3-7(2-5)10(14)15/h1-3H | | InChIKey | JZPRXQSCMBDGKP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)N=C=O |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-42 | | Safety Statements | 22-26-36 | | RIDADR | UN 3335 | | WGK Germany | 3 | | F | 4.10-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 3,5-Dinitrophenyl isocyanate Usage And Synthesis |
| | 3,5-Dinitrophenyl isocyanate Preparation Products And Raw materials |
|