| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(Boc-aminomethyl)phenyl isothiocyanate Basic information |
| Product Name: | 4-(Boc-aminomethyl)phenyl isothiocyanate | | Synonyms: | TERT-BUTYL N-(4-ISOTHIOCYANATOPHENYLMETHYL)CARBAMATE;N-BOC-4-ISOTHIOCYANATOBENZYLAMINE;BAMPITC;4-(N-TERT-BUTOXYCARBONYLAMINOMETHYL)PHENYL ISOTHIOCYANATE;4-(N-T-BOC-AMINOMETHYL)PHENYLISOTHIOCYAN ATE;tert-Butyl N-(4-isothiocyanatophenylmethyl)carbamate, BAMPITC, N-Boc-4-isothiocyanatobenzylamine, 4-(N-tert-Butoxycarbonylaminomethyl)phenyl isothiocyanate;4-(Boc-aminomethyl)phenyl isothiocyanate ~95%;Carbamic acid, N-[(4-isothiocyanatophenyl)methyl]-, 1,1-dimethylethyl ester | | CAS: | 89631-74-3 | | MF: | C13H16N2O2S | | MW: | 264.34 | | EINECS: | | | Product Categories: | | | Mol File: | 89631-74-3.mol |  |
| | 4-(Boc-aminomethyl)phenyl isothiocyanate Chemical Properties |
| Melting point | 111-113 °C | | Boiling point | 416.0±38.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.93±0.46(Predicted) | | InChI | 1S/C13H16N2O2S/c1-13(2,3)17-12(16)14-8-10-4-6-11(7-5-10)15-9-18/h4-7H,8H2,1-3H3,(H,14,16) | | InChIKey | FZQIQTXXAATZOS-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1ccc(cc1)N=C=S |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-42 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
STOT SE 3 |
| | 4-(Boc-aminomethyl)phenyl isothiocyanate Usage And Synthesis |
| Uses | Novel protein microsequencing reagent useful with more sensitive fluorogenic detection methods. |
| | 4-(Boc-aminomethyl)phenyl isothiocyanate Preparation Products And Raw materials |
|