|
|
| | tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate Basic information |
| Product Name: | tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate | | Synonyms: | (5-BROMO-THIOPHEN-2-YLMETHYL)-CARBAMIC ACID TERT-BUTYL ESTER;tert-butyl (5-bromothiophen-2-yl)methylcarbamate;2-[(Boc-amino)methyl]-5-bromothiophene;N-Boc-5-bromothiophene-2-methylamine;N-Boc-5-bromothiophen-2-methanamine;N-[(5-bromo-2-thiophenyl)methyl]carbamic acid tert-butyl ester;Carbamic acid, N-[(5-bromo-2-thienyl)methyl]-, 1,1-dimethylethyl ester;2-[(Boc-amino)methyl]-5-bromothiophene | | CAS: | 215183-27-0 | | MF: | C10H14BrNO2S | | MW: | 292.19 | | EINECS: | | | Product Categories: | | | Mol File: | 215183-27-0.mol | ![tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate Structure](CAS/GIF/215183-27-0.gif) |
| | tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate Chemical Properties |
| Melting point | 51 °C | | Boiling point | 371.048±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.416±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | >110℃ | | storage temp. | Storage temp. 2-8°C | | pka | 11.485±0.46(predicted) | | form | solid | | color | Light brown | | InChI | 1S/C10H14BrNO2S/c1-10(2,3)14-9(13)12-6-7-4-5-8(11)15-7/h4-5H,6H2,1-3H3,(H,12,13) | | InChIKey | CVNITIPQHIGCKI-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1ccc(Br)s1 | | CAS DataBase Reference | 215183-27-0 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate Usage And Synthesis |
| | tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate Preparation Products And Raw materials |
|