C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride manufacturers
|
| | C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride Basic information |
| Product Name: | C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride | | Synonyms: | (5-BROMOTHIOPHEN-2-YL)METHANAMINE HYDROBROMIDE;2-Aminomethyl-5-bromothiophenem, HBr;(5-bromo-2-thienyl)methanamine hydrochloride;(5-bromothiophen-2-yl)methanamine HCl;2-Thiophenemethanamine, 5-bromo-, hydrochloride (1:1);(5-broMothiophen-2-yl)MethanaMine hydrochloride;C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride | | CAS: | 1001414-56-7 | | MF: | C5H7BrClNS | | MW: | 228.53 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H6BrNS.ClH/c6-5-2-1-4(3-7)8-5;/h1-2H,3,7H2;1H | | InChIKey | DWYVWUCEDHIAMH-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)S1)N.Cl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | HS Code | 2934999090 |
| | C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride Usage And Synthesis |
| Synthesis | General procedure for the synthesis of (5-bromothiophen-2-yl)methylamine hydrochloride from tert-butyl (5-bromothiophen-2-yl)methylcarbamate: tert-butyl (5-bromothiophen-2-yl)methylcarbamate (8.322 g, 0.0285 mmol) was dissolved in 150 mL of anhydrous ethyl acetate. After continuous passage of dry HCl gas for 2 h, a large amount of precipitate generation was observed. Upon completion of the reaction, the solvent was removed by distillation under reduced pressure. The resulting residue was washed sequentially with anhydrous ethyl acetate (3 x 50 mL) and ether (3 x 50 mL) to give the final target product (5-bromothiophen-2-yl)methylamine hydrochloride (5.862 g) in 95% yield. | | References | [1] Patent: WO2008/5457, 2008, A2. Location in patent: Page/Page column 185 |
| | C-(5-Bromo-thiophen-2-yl)-methylamine hydrochloride Preparation Products And Raw materials |
|