|
|
| | 1-(2-Bromoethoxy)-4-nitrobenzene Basic information |
| | 1-(2-Bromoethoxy)-4-nitrobenzene Chemical Properties |
| Melting point | 62-65 °C | | Boiling point | 170 °C / 0.5mmHg | | density | 1.587±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly), Ethyl Acetat | | form | Powder or Crystals | | color | Yellow | | InChI | InChI=1S/C8H8BrNO3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,5-6H2 | | InChIKey | YQWCBDNNEZHPMA-UHFFFAOYSA-N | | SMILES | C1(OCCBr)=CC=C([N+]([O-])=O)C=C1 |
| Provider | Language |
|
ACROS
| English |
| | 1-(2-Bromoethoxy)-4-nitrobenzene Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Synthesis Reference(s) | Synthesis, p. 693, 1972 DOI: 10.1055/s-1972-21970 |
| | 1-(2-Bromoethoxy)-4-nitrobenzene Preparation Products And Raw materials |
|