|
|
| | 1-Hydroxy-1-cyclopropanecarboxylic acid Basic information |
| | 1-Hydroxy-1-cyclopropanecarboxylic acid Chemical Properties |
| Melting point | 108-110 °C(lit.) | | Boiling point | 276.57°C | | density | 1.6760 | | refractive index | 1.5130 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform+DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Fine Crystalline Powder | | pka | 3.94±0.20(Predicted) | | color | Beige | | InChI | InChI=1S/C4H6O3/c5-3(6)4(7)1-2-4/h7H,1-2H2,(H,5,6) | | InChIKey | GQXURJDNDYACGE-UHFFFAOYSA-N | | SMILES | C1(O)(C(O)=O)CC1 | | CAS DataBase Reference | 17994-25-1(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34-22 | | Safety Statements | 26-36-45-36/37/39 | | WGK Germany | 3 | | HS Code | 29181998 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Hydroxy-1-cyclopropanecarboxylic acid Usage And Synthesis |
| Chemical Properties | Beige fine crystalline powder | | Uses | A hydroxycarboxylic acid as additive enhancing topical actions of therapeutic agents. | | Synthesis Reference(s) | Tetrahedron Letters, 25, p. 1269, 1984 DOI: 10.1016/S0040-4039(01)80131-3 |
| | 1-Hydroxy-1-cyclopropanecarboxylic acid Preparation Products And Raw materials |
|