|
|
| | DECANOIC ANHYDRIDE Basic information |
| Product Name: | DECANOIC ANHYDRIDE | | Synonyms: | CAPRIC ANHYDRIDE;DECANOIC ANHYDRIDE;N-DECANOIC ANHYDRIDE;N-CAPRIC ANHYDRIDE;n-capricanhtdride;CAPRIC ANHYDRIDE (C10:0);Bis(decanoic acid)anhydride;Didecanoic anhydride | | CAS: | 2082-76-0 | | MF: | C20H38O3 | | MW: | 326.52 | | EINECS: | 218-213-4 | | Product Categories: | | | Mol File: | 2082-76-0.mol |  |
| | DECANOIC ANHYDRIDE Chemical Properties |
| Melting point | 24-25 °C (lit.) | | Boiling point | 125-140 °C/0.05 mmHg (lit.) | | density | 0.886 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.44(lit.) | | Fp | >230 °F | | storage temp. | −20°C | | solubility | chloroform: soluble100mg/mL, clear, colorless to light yellow | | form | Melting Solid | | color | Colorless to light yellow | | InChI | 1S/C20H38O3/c1-3-5-7-9-11-13-15-17-19(21)23-20(22)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 | | InChIKey | HTWWKYKIBSHDPC-UHFFFAOYSA-N | | SMILES | CCCCCCCCCC(=O)OC(=O)CCCCCCCCC | | CAS DataBase Reference | 2082-76-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | DECANOIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow low melting solid | | Uses | Decanoic anhydride was used in the synthesis of 2-deoxy-2-p-methoxybenzylimideneaminio-1,3,4,6-tetra-O-decanoyl-D-glucopyranose. |
| | DECANOIC ANHYDRIDE Preparation Products And Raw materials |
|