| Company Name: |
Handan Huajun Chemicals Co., Ltd.
|
| Tel: |
13303008150 |
| Email: |
884971191@qq.com |
| Products Intro: |
Product Name:Undecanoic acid
CAS:2082-77-1
Purity:99% Package:200kg
|
undecanoic anhydride manufacturers
- Undecanoic anhydride
-
- $1.00
-
2026-07-24
- CAS:2082-77-1
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 1000MT
|
| | undecanoic anhydride Basic information |
| Product Name: | undecanoic anhydride | | Synonyms: | undecanoic anhydride;Bisundecanoic anhydride;Undecansaeureanhydrid;Undecanoic acid, anhydride | | CAS: | 2082-77-1 | | MF: | C22H42O3 | | MW: | 354.57 | | EINECS: | 218-215-5 | | Product Categories: | | | Mol File: | 2082-77-1.mol |  |
| | undecanoic anhydride Chemical Properties |
| Melting point | 35 °C(Solv: acetone (67-64-1)) | | Boiling point | 210-245 °C | | density | 0.903±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C22H42O3/c1-3-5-7-9-11-13-15-17-19-21(23)25-22(24)20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3 | | InChIKey | DGJTZXXNXZVULP-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCCCCCCCCC)(=O)CCCCCCCCCC |
| | undecanoic anhydride Usage And Synthesis |
| Uses | In organic synthesis, undecanoic anhydride is commonly used to introduce 11-carbon chains (the undecanoyl group) into molecules. |
| | undecanoic anhydride Preparation Products And Raw materials |
|