|
| (S)-1-Benzyl-3-pyrrolidinol Basic information |
| (S)-1-Benzyl-3-pyrrolidinol Chemical Properties |
alpha | -3.7 º (c=5, MeOH) | Boiling point | 115 °C0.8 mm Hg(lit.) | density | 1.07 g/mL at 25 °C(lit.) | refractive index | n20/D 1.548(lit.) | Fp | >230 °F | storage temp. | 2-8°C | form | Liquid | pka | 14.82±0.20(Predicted) | color | Clear light yellow to pale brown | Optical Rotation | [α]24/D 3.7°, c = 5 in methanol | BRN | 4982831 | InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2/t11-/m0/s1 | InChIKey | YQMXOIAIYXXXEE-NSHDSACASA-N | SMILES | N1(CC2=CC=CC=C2)CC[C@H](O)C1 | CAS DataBase Reference | 101385-90-4(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HS Code | 29339900 |
| (S)-1-Benzyl-3-pyrrolidinol Usage And Synthesis |
Chemical Properties | Clear light yellow liquid | Uses | For synthesis of optically active products |
| (S)-1-Benzyl-3-pyrrolidinol Preparation Products And Raw materials |
|