|
|
| | (R)-(+)-1-Benzyl-3-pyrrolidinol Basic information |
| | (R)-(+)-1-Benzyl-3-pyrrolidinol Chemical Properties |
| alpha | 3.7 º (c=5, MeOH) | | Boiling point | 116 °C0.9 mm Hg(lit.) | | density | 1.07 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.548(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 14.82±0.20(Predicted) | | form | clear liquid to slightly cloudy liquid | | color | Light yellow to Yellow to Orange | | Specific Gravity | 1.07 | | Optical Rotation | [α]23/D +3.7°, c = 5 in methanol | | InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2/t11-/m1/s1 | | InChIKey | YQMXOIAIYXXXEE-LLVKDONJSA-N | | SMILES | N1(CC2=CC=CC=C2)CC[C@@H](O)C1 | | CAS DataBase Reference | 101930-07-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29339900 |
| | (R)-(+)-1-Benzyl-3-pyrrolidinol Usage And Synthesis |
| Chemical Properties | Colorless to light yellow to gold to brown liquid | | Uses | (R)-(+)-1-Benzyl-3-pyrrolidinol, is a chiral building block used for the synthesis of various pharmaceutical and biologically active compounds. It can be used for the preparation of beta-proline like derivatives, acting as sodium channel blockers |
| | (R)-(+)-1-Benzyl-3-pyrrolidinol Preparation Products And Raw materials |
|