| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Basic information |
| Product Name: | (2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester | | Synonyms: | (2S,3R)-(-)-4-BENZYLOXY-2,3-EPOXY-1-BUTYL 4-NITROBENZOATE;(2S,3R)-p-nitrobenzoesaeure-(4-benzyloxy-2,3-epoxy-1-butyl)ester;2-Oxiranemethanol, 3-[(phenylmethoxy)methyl]-, 2-(4-nitrobenzoate), (2S,3R)-;(2S,3R)-(?)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester;(2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester | | CAS: | 78513-08-3 | | MF: | C18H17NO6 | | MW: | 343.33 | | EINECS: | | | Product Categories: | | | Mol File: | 78513-08-3.mol |  |
| | (2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Chemical Properties |
| Melting point | 78-80 °C | | Optical Rotation | [α]20/D 34±1°, c = 0.5% in chloroform | | BRN | 5383514 | | InChI | 1S/C18H17NO6/c20-18(14-6-8-15(9-7-14)19(21)22)24-12-17-16(25-17)11-23-10-13-4-2-1-3-5-13/h1-9,16-17H,10-12H2/t16-,17+/m1/s1 | | InChIKey | XBAOYRZETQXAAE-SJORKVTESA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)C(=O)OC[C@@H]2O[C@@H]2COCc3ccccc3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Usage And Synthesis |
| | (2S,3R)-(-)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Preparation Products And Raw materials |
|