| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Pharmalego |
| Tel: |
18321033991 |
| Email: |
marketing@pharmalego.com |
(2R)-(-)-Glycidyl 4-nitrobenzoate manufacturers
|
| | (2R)-(-)-Glycidyl 4-nitrobenzoate Basic information |
| Product Name: | (2R)-(-)-Glycidyl 4-nitrobenzoate | | Synonyms: | (2r)-(-)-(2,3-epoxypropylester)-4-nitrobenzoate;4-nitrobenzoate,(r)-oxiranemethano;(R)-(-)-GLYCIDYL-4-NITROBENZOATE;GLYCIDYL4-NITROBENZOATE;(R)-(-)-Oxirane-2-methanol 4-nitrobenzoate;(R)-(-)-Glycidyl 4-nitrobenzoate, (R)-(-)-Oxirane-2-methanol 4-nitrobenzoate;2-Oxiranemethanol, 2-(4-nitrobenzoate), (2R)-;(R)-oxiran-2-ylmethyl 4-nitrobenzoate | | CAS: | 106268-95-5 | | MF: | C10H9NO5 | | MW: | 223.18 | | EINECS: | | | Product Categories: | | | Mol File: | 106268-95-5.mol |  |
| | (2R)-(-)-Glycidyl 4-nitrobenzoate Chemical Properties |
| Melting point | 60-62 °C (lit.) | | storage temp. | 2-8°C | | form | solid | | Optical Rotation | [α]19/D 37°, c = 1.08 in chloroform | | BRN | 5278590 | | InChI | 1S/C10H9NO5/c12-10(16-6-9-5-15-9)7-1-3-8(4-2-7)11(13)14/h1-4,9H,5-6H2/t9-/m1/s1 | | InChIKey | MUWIANZPEBMVHH-SECBINFHSA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)C(=O)OC[C@H]2CO2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RR0511000 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (2R)-(-)-Glycidyl 4-nitrobenzoate Usage And Synthesis |
| Uses | (2R)-()-Glycidyl 4-nitrobenzoate can be used as a starting material in the total synthesis of leukotriene B4. | | Purification Methods | Purify glycidol by fractional distillation.The 4-nitrobenzoates have m 56o (±); m 60-62o, [] D20 -37.9o (c 3.38 CHCl3) for R-(-)-isomer [106268-95-5];m 60-62o, [] D20 +38o (c 1 CHCl3) for the S-(+)-isomer [115459-65-9] and are recrystallised from Et2O or Et2O/pet ether (b 40-60o) [S-isomer: Burgos et al. J Org Chem 52 4973 1987, Sowden & Fischer J Am Chem Soc 64 1291 1942.] [Beilstein 17 I 50, 17 III/IV 985, 17/3 V 9.] |
| | (2R)-(-)-Glycidyl 4-nitrobenzoate Preparation Products And Raw materials |
|