| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
D-LACTAL manufacturers
- D-Lactal
-
-
2026-09-18
- CAS:65207-55-8
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | D-LACTAL Basic information |
| Product Name: | D-LACTAL | | Synonyms: | D-LACTAL;1,5-Anhydro-2-deoxy-4-O-β-D-galactopyranosyl-D-arabino-hexa-1-enitol;4-O-β-D-Galactopyranosyl-1,5-anhydro-2-deoxy-D-arabino-hexa-1-enitol;Lactal;D-Lactal ,98%;1,5-anhydro-2-deoxy-4-o-β-d-galactopyranosyl-d-arabinohex-1-enitol;D-Lactal 97%;D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-4-O-β-D-galactopyranosyl- | | CAS: | 65207-55-8 | | MF: | C12H20O9 | | MW: | 308.28 | | EINECS: | | | Product Categories: | | | Mol File: | 65207-55-8.mol |  |
| | D-LACTAL Chemical Properties |
| Melting point | 196-199 °C (lit.) | | Boiling point | 612.0±55.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 12.59±0.60(Predicted) | | form | solid | | Optical Rotation | [α]20/D +26.5°, c = 1 in H2O | | InChI | 1S/C12H20O9/c13-3-6-8(16)9(17)10(18)12(20-6)21-11-5(15)1-2-19-7(11)4-14/h1-2,5-18H,3-4H2/t5-,6-,7-,8+,9+,10-,11+,12+/m1/s1 | | InChIKey | HNXRLRRQDUXQEE-ALURDMBKSA-N | | SMILES | OC[C@H]1OC=C[C@@H](O)[C@@H]1O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | D-LACTAL Usage And Synthesis |
| Uses | Important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| | D-LACTAL Preparation Products And Raw materials |
|