| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
13-CIS-RETINAL manufacturers
- 13-CIS-RETINAL
-
- $30.00
-
2026-08-07
- CAS:472-86-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | 13-CIS-RETINAL Basic information |
| | 13-CIS-RETINAL Chemical Properties |
| Melting point | 65-69°C | | Boiling point | 366.92°C (rough estimate) | | density | 1.0083 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow to Dark Yellow | | biological source | synthetic (organic) | | Stability: | Light Sensitive | | InChI | 1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13- | | InChIKey | NCYCYZXNIZJOKI-HWCYFHEPSA-N | | SMILES | [H]C(=O)C(/[H])=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C | | EPA Substance Registry System | Retinal, 13-cis- (472-86-6) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-38 | | Safety Statements | 22-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Irrit. 2 |
| | 13-CIS-RETINAL Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | An isomer of all-trans-Retinal (R240000). | | Definition | ChEBI: A retinal in which the double bond alpha- to the aldehyde group has cis configuration, whilst the remaining acyclic double bonds have trans configuration. |
| | 13-CIS-RETINAL Preparation Products And Raw materials |
|