|
|
| | 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Basic information |
| Product Name: | 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL | | Synonyms: | 2-(4-HYDROXY-3,5-DIMETHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL;2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol,min.97%;3,5-Dimethyl-4-hydroxybenzeneboronic acid, pinacol ester;2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-;3,5-Dimethyl-4-hydroxyphenylboronic acid pinacol ester, 4-Hydroxy-3,5-dimethylphenylboronic acid, pinacol cyclic ester, 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, min. 97%;2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol,97% | | CAS: | 269410-25-5 | | MF: | C14H21BO3 | | MW: | 248.13 | | EINECS: | | | Product Categories: | organic or inorganic borate;B (Classes of Boron Compounds);Boronic Acids Esters;Phenoles and thiophenoles;Heterocyclic Compounds | | Mol File: | 269410-25-5.mol |  |
| | 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Chemical Properties |
| Melting point | 100-105 °C (lit.) | | Boiling point | 367.3±42.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | Crystalline Powder | | pka | 10.36±0.40(Predicted) | | color | White to beige | | InChI | 1S/C14H21BO3/c1-9-7-11(8-10(2)12(9)16)15-17-13(3,4)14(5,6)18-15/h7-8,16H,1-6H3 | | InChIKey | TYCKOBOJYNRIBO-UHFFFAOYSA-N | | SMILES | Cc1cc(cc(C)c1O)B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 269410-25-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Usage And Synthesis |
| Chemical Properties | white to beige crystalline powder | | Uses | 3,5-Dimethyl-4-hydroxyphenylboronic acid, pinacol ester |
| | 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Preparation Products And Raw materials |
|