| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | ETIOPORPHYRIN I NICKEL Basic information |
| Product Name: | ETIOPORPHYRIN I NICKEL | | Synonyms: | Etioporphyrin Nickel;Etioporphyrin Ⅰ nickel;ETIOPORPHYRIN I NICKEL;nickel(2+),2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide;Nickle (II) etioporphyrin;Ni (II) etioporphyrin;Ni(II) Etioporphyrin I | | CAS: | 14055-19-7 | | MF: | C32H36N4Ni | | MW: | 535.35 | | EINECS: | | | Product Categories: | Pharmaceutical Intermediates;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Porphyrines | | Mol File: | 14055-19-7.mol |  |
| | ETIOPORPHYRIN I NICKEL Chemical Properties |
| storage temp. | Store at Room Tem. | | λmax | 392 nm | | InChIKey | SPKLBIKKHWTZSI-UGIVYKKHSA-N | | SMILES | CCc1c(C)c2cc3c(CC)c(C)c4cc5nc(cc6c(CC)c(C)c(cc1n2)n6[Ni]n34)c(C)c5CC |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | ETIOPORPHYRIN I NICKEL Usage And Synthesis |
| Uses | Etioporphyrin I Nickel is a platinum (II) based porphyrin porphyrin with the potential to be a transistor. Acts as a catalyst in metal porphyrins for hydrocarbon cracking or hydrogenation. | | Uses | Ni-EP can be used to fabricate a field effect transistor (FET). | | General Description | Nickel can be removed from nickel etioporphyrin (Ni-EP) by using supercritical water (SCW) at a temperature of 500°C and a pressure of 50MPa.
|
| | ETIOPORPHYRIN I NICKEL Preparation Products And Raw materials |
|