| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) Basic information |
| Product Name: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) | | Synonyms: | Nickel(II)octaethylporphine;octaethyl-21H,23H-porphine nickel(II);2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphineni;Nickel octaethylporphyrin;Ni-OEP complex;2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II);NI(II) OCTAETHYLPORPHINE;RARECHEM AS SA 0079 | | CAS: | 24803-99-4 | | MF: | C36H44N4Ni | | MW: | 591.45 | | EINECS: | | | Product Categories: | NickelPhotonic and Optical Materials;Catalysis and Inorganic Chemistry;Chemical Synthesis;Phthalocyanine and Porphyrin Dyes;Porphyrines;Porphyrins;Synthetic Porphyrins | | Mol File: | 24803-99-4.mol |  |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) Chemical Properties |
| Melting point | >300 °C | | form | solid | | λmax | 392 nm | | InChIKey | DIGQQRGHPATISA-XTPDIVBZSA-N | | SMILES | CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Ni]n34)c(CC)c5CC |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) Usage And Synthesis |
| Uses | Nickel octaethylporphyrin can be synthesized by the metalation of 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine with nickel (II). | | General Description | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel can be formed by metalating 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine with nickel (II).1 | | reaction suitability | reagent type: catalyst core: nickel | | References | [1] Self and nonself recognition with bacterial and animal glycans, surveys by synthetic chemistry [2] Self and nonself recognition with bacterial and animal glycans, surveys by synthetic chemistry. [3] A simple HPLC method for analysing diaminopimelic acid diastereomers in cell walls of Gram-positive bacteria [4] Enzymic assays for isomers of 2,6-diaminopimelic acid in walls of Bacillus cereus and Bacillus megaterium |
| | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) Preparation Products And Raw materials |
|