| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Carboxymethyl-phenylboronic acid Basic information |
| | 4-Carboxymethyl-phenylboronic acid Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 416.1±47.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.23±0.10(Predicted) | | color | White to Off-White | | InChI | 1S/C8H9BO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4,12-13H,5H2,(H,10,11) | | InChIKey | NFGJQVPDPIGBJE-UHFFFAOYSA-N | | SMILES | OB(O)C1=CC=C(CC(O)=O)C=C1 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Carboxymethyl-phenylboronic acid Usage And Synthesis |
| Uses | 4-Carboxymethylphenylboronic acid |
| | 4-Carboxymethyl-phenylboronic acid Preparation Products And Raw materials |
|