| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Bromochlorobenzene-d4 Basic information |
| Product Name: | 2-Bromochlorobenzene-d4 | | Synonyms: | 1-Chloro-2-bromobenzene-3,4,5,6-d4;1-Bromo-2-chlorobenzene-d4;1-Bromo-2-chlorobenzene-3,4,5,6-d4;2-Bromochlorobenzene-d4 | | CAS: | 1219795-51-3 | | MF: | C6BrClD4 | | MW: | 195.477607112 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Bromochlorobenzene-d4 Chemical Properties |
| form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C6H4BrCl/c7-5-3-1-2-4-6(5)8/h1-4H/i1D,2D,3D,4D | | InChIKey | QBELEDRHMPMKHP-RHQRLBAQSA-N | | SMILES | C1(Cl)=C([2H])C([2H])=C([2H])C([2H])=C1Br |
| | 2-Bromochlorobenzene-d4 Usage And Synthesis |
| Uses | 5-Bromo-6-chlorobenzene-1,2,3,4-d4 is the isotope labelled compound of (B682312) which is a reagent in the preparation of arylpiperidines and aryltetrahydropyridines as 5-HT2C agonists. |
| | 2-Bromochlorobenzene-d4 Preparation Products And Raw materials |
|