| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | (cis) tert-Butyl-3-hydroxycyclobutyl carbamate | | Synonyms: | Carbamic acid, (cis-3-hydroxycyclobutyl)-, 1,1-dimethylethyl ester (9CI);cis-tert-Butyl N-(3-hydroxycyclobutyl)carbamate;tert-Butyl (cis-3-hydroxycyclobutyl)carbamate 97%;cis-tert-Butyl 3-hydroxyc...;CarbaMic acid, (cis-3-hydroxycyclobutyl)-, 1,1-diMethylethyl ester;cis-3-(Boc-amino)-cyclobutanol;tert-butyl (3-hydroxycyclobutyl)carate;cis-2-(Boc-amino)-cyclobutanol | | CAS: | 389890-43-1 | | MF: | C9H17NO3 | | MW: | 187.24 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 389890-43-1.mol |  |
| | (cis) tert-Butyl-3-hydroxycyclobutyl carbamate Chemical Properties |
| Melting point | 117 °C | | Boiling point | 303.7±31.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.19±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-6-4-7(11)5-6/h6-7,11H,4-5H2,1-3H3,(H,10,12)/t6-,7+ | | InChIKey | WSUMHFNEPOYLJM-KNVOCYPGSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@H](O)C1 |
| | (cis) tert-Butyl-3-hydroxycyclobutyl carbamate Usage And Synthesis |
| Synthesis | Using cis-3-aminocyclobutanol as the starting material, the target compound (CIS) TERT-BUTYL-3-HYDROXYCYCLOBUTYL CARBAMATE was prepared by amino protection with di-tert-butyl dicarbonate. The synthetic reaction formula of (CIS) TERT-BUTYL-3-HYDROXYCYCLOBUTYL CARBAMATE is shown in the figure below: 
| | Application | Amino alcohols, with their skeletal structure, are widely found in natural products and bioactive molecules. These compounds serve as effective intermediates in pharmaceutical chemistry, providing a wealth of research material for drug development. Furthermore, the two heteroatoms (N, O) of amino alcohols offer high flexibility, allowing one or both heteroatoms to bond with Lewis acids, transition metals, or achiral substrates. This makes them widely applicable in asymmetric synthesis, such as asymmetric reduction and addition of carbonyl groups, asymmetric Diels-Alder cycloaddition reactions, asymmetric 1,2-dipolar cycloaddition reactions, and Heck reactions. |
| | (cis) tert-Butyl-3-hydroxycyclobutyl carbamate Preparation Products And Raw materials |
|