(3-Iodo-phenyl)-carbamic acid tert-butyl ester manufacturers
|
| | (3-Iodo-phenyl)-carbamic acid tert-butyl ester Basic information |
| Product Name: | (3-Iodo-phenyl)-carbamic acid tert-butyl ester | | Synonyms: | N-(3-Iodophenyl)-1,1-diMethylethyl Ester CarbaMic Acid;TERT-BUTYL 3-IODOPHENYLCARBAMATE;1-Iodo-3-[(tert-butyloxycarbonyl)aMino]benzene;N-Boc 3-iodoaniline;N-(tert-Butoxycarbonyl)-3-iodoaniline;iodo-3-(tert-butyloxycarbonylamino)benzene;Carbamic acid, N-(3-iodophenyl)-, 1,1-dimethylethyl ester;tert-butyl N-(3-iodophenyl)carbamate | | CAS: | 143390-49-2 | | MF: | C11H14INO2 | | MW: | 319.14 | | EINECS: | | | Product Categories: | Aromatics;Intermediates | | Mol File: | 143390-49-2.mol |  |
| | (3-Iodo-phenyl)-carbamic acid tert-butyl ester Chemical Properties |
| Melting point | 71-75°C | | Boiling point | 303.5±25.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Dichloromethane, Ethyl Acetate | | pka | 13.30±0.70(Predicted) | | form | Oil | | color | Yellow | | InChI | 1S/C11H14INO2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h4-7H,1-3H3,(H,13,14) | | InChIKey | MPCQRNOVFYBCTQ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Nc1cccc(I)c1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50 | | Safety Statements | 36/37-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | (3-Iodo-phenyl)-carbamic acid tert-butyl ester Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | N-(3-Iodophenyl)-1,1-dimethylethyl Ester Carbamic Acid (cas# 143390-49-2) is a compound useful in organic synthesis. |
| | (3-Iodo-phenyl)-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|