|
|
| | 3-Methoxycarbonylphenylboronic acid pinacol ester Basic information |
| Product Name: | 3-Methoxycarbonylphenylboronic acid pinacol ester | | Synonyms: | 3-Carbomethoxyphenylboronic acid pinacol ester, Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate,97%;3-METHOXYCARBONYLPHENYLBORONIC ACID, PINACOL ESTER;3-carbomethoxyphenylboronic acid pinacol ester;3-(Methoxycarbonyl)benzeneboronic acid, pinacol ester;3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)benzoic Acid Methyl Ester;3-Methoxycarbonylphenylboronic acid pinacol ester
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;3-Methoxycarbonylphenylboronic acid pinacol ester 97% | | CAS: | 480425-35-2 | | MF: | C14H19BO4 | | MW: | 262.11 | | EINECS: | | | Product Categories: | Acids and Derivatives;Boron, Nitrile, Thio,& TM-Cpds;Imidazoles ,Homopiperidines | | Mol File: | 480425-35-2.mol |  |
| | 3-Methoxycarbonylphenylboronic acid pinacol ester Chemical Properties |
| Melting point | 91-95 °C (lit.) | | Boiling point | 364.3±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble | | InChI | 1S/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)11-8-6-7-10(9-11)12(16)17-5/h6-9H,1-5H3 | | InChIKey | JBJGSVBGUBATNH-UHFFFAOYSA-N | | SMILES | COC(=O)c1cccc(c1)B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 480425-35-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | 3-Methoxycarbonylphenylboronic acid pinacol ester Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 3-Methoxycarbonylphenylboronic Acid Pinacol Ester is used in the preparation of non-noviosylated coumermycin A1 analogs targeting heat shock protein 90 dimer with dimeric inhibitors. |
| | 3-Methoxycarbonylphenylboronic acid pinacol ester Preparation Products And Raw materials |
| Raw materials | 3-CARBOMETHOXY-2-PYRONE-->2-Ethynyl-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane-->METHYL 2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOATE-->Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate-->Methyl benzoate-->Bis(pinacolato)diboron | | Preparation Products | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol |
|