| Company Name: |
Shandong Mingde Biotechnology Co., Ltd
|
| Tel: |
15553348166 |
| Email: |
m15553348166@163.com |
| Products Intro: |
Product Name:ethyl [4-(1,1-dimethylethyl)phenoxy]acetate CAS:3344-19-2 Purity:99% Package:1KG
|
| Company Name: |
Shandong Welt Chem. Co.,Ltd.
|
| Tel: |
531-87153728 13805401165 |
| Email: |
xufeng192@126.com |
| Products Intro: |
Product Name:ethyl 2-(4-tert-butylphenoxy)acetate CAS:3344-19-2 Purity:99% GC Package:500克,1kg,5kg,10kg
|
| Company Name: |
Yanggu Rongke Trading Co., Ltd
|
| Tel: |
15863541132 |
| Email: |
18366413387@163.com |
| Products Intro: |
Product Name:ethyl 2-(4-tert-butylphenoxy)acetate CAS:3344-19-2 Purity:98% Package:1g/
|
| Company Name: |
Shandong Jiuyue Biotechnology Co., Ltd.
|
| Tel: |
15553333686 |
| Email: |
643971@qq.com |
| Products Intro: |
Product Name:ethyl [4-(1,1-dimethylethyl)phenoxy]acetate CAS:3344-19-2 Purity:99% Package:1KG
|
|
| | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate Basic information |
| Product Name: | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate | | Synonyms: | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate;(4-tert-Butylphenoxy)acetic acid ethyl ester;p-tert-Butylphenoxyacetic acid ethyl ester;Acetic acid, 2-[4-(1,1-dimethylethyl)phenoxy]-, ethyl ester | | CAS: | 3344-19-2 | | MF: | C14H20O3 | | MW: | 236.31 | | EINECS: | 222-094-4 | | Product Categories: | | | Mol File: | 3344-19-2.mol | ![ethyl [4-(1,1-dimethylethyl)phenoxy]acetate Structure](CAS/GIF/3344-19-2.gif) |
| | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate Chemical Properties |
| Boiling point | 180-182 °C(Press: 15 Torr) | | density | 1.013±0.06 g/cm3(Predicted) | | InChI | 1S/C14H20O3/c1-5-16-13(15)10-17-12-8-6-11(7-9-12)14(2,3)4/h6-9H,5,10H2,1-4H3 | | SMILES | CC(C)(C)C(C=C1)=CC=C1OCC(OCC)=O |
| | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate Usage And Synthesis |
| | ethyl [4-(1,1-dimethylethyl)phenoxy]acetate Preparation Products And Raw materials |
|