| Company Name: |
Selectoprobe Gold |
| Tel: |
15156792748 |
| Email: |
li_kang@selectoprobe.com |
|
| | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester Basic information |
| Product Name: | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester | | Synonyms: | 5,11,17,23-tetra-tert-butyl-[25,26,27,28-(ethylethanoate)oxy]-calix[4]arene;5,11,17,23-P-TERTBUTYL-25,26,27,28-TETRAKIS-[(ETHOXYCARBONYL)METHOXY]-CALIX[4]ARENE;4-T-BUTYLCALIX[4]ARENE-O,O',O'',O'''-TETRAACETIC ACID TETRAETHYL ESTER;4-TERT-BUTYLCALIX[4]ARENE-O,O',O'',O'''-TETRAACETIC ACID TETRAETHYL ESTER;4-t-Butylcalix4arene-O,O',O",O'"-tetraaceticacidtetraethylester,97%;4-TERT-BUTYLCALIX(4)ARENE-TETRAACETIC AC . TETRAETHYL ESTER;TETRAESTER 4-TERT-BUTYLCALIX(4)ARENE;Tetraethyl 4-tert-Butylcalix[4]arene-O,O',O'',O'''-tetraacetate | | CAS: | 97600-39-0 | | MF: | C60H80O12 | | MW: | 993.27 | | EINECS: | | | Product Categories: | Pharm intermediate;pharmacetical;Calixarenes;Functional Materials;Macrocycles for Host-Guest Chemistry;Chelation/Complexation Compounds;Synthetic Reagents | | Mol File: | 97600-39-0.mol | ![4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester Structure](CAS/GIF/97600-39-0.gif) |
| | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester Chemical Properties |
| Melting point | 155-158 °C | | Boiling point | 788.39°C (rough estimate) | | density | 0.9747 (rough estimate) | | refractive index | 1.7500 (estimate) | | form | powder to crystal | | color | White to Almost white | | BRN | 3587002 | | InChIKey | HZHADWCIBZZJNV-UHFFFAOYSA-N | | SMILES | C12=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)C2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester (CAS# 97600-39-0) is a calix[n]arene and chelating agent, able to complex with alkali metal cations in water in the presence of counterions and a buffer solution. 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester has also been used in wearable technology, such as skin-mounted microfluidic potentiometric device for electrochemical monitoring of sodium and potassium in sweat. |
| | 4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester Preparation Products And Raw materials |
|