| Company Name: |
NORANA GROUP Gold |
| Tel: |
027-59209883 17386138556 |
| Email: |
service@nornachem.com |
|
| | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane Basic information |
| Product Name: | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane | | Synonyms: | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane;Cyclotetrasiloxane, 2,4,6,8-tetramethyl-2,4,6,8-tetraphenyl-;2,4,6,8-Tetramethyl-2,4,6,8-tetraphenyl-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclooctane;2,4,6,8-Tetramethyl-2,4,6,8-tetraphenylcyclooctanetetrasiloxane;2,4,6,8-Tetraphenyl-2,4,6,8-tetramethylcyclooctanetetrasiloxane;Tetrtaphenyltetramethylcyclotetrasiloxane;1,3,5,7-Tetramethyltetraphenylcyclotetrasiloxane;2,4,6,8-Tetramethyl-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane | | CAS: | 77-63-4 | | MF: | C28H32O4Si4 | | MW: | 544.89 | | EINECS: | 201-045-0 | | Product Categories: | Catalysis and Inorganic Chemistry;Chemical Synthesis | | Mol File: | 77-63-4.mol |  |
| | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane Chemical Properties |
| Melting point | 99°C | | Boiling point | 237 °C | | density | 1.13 | | refractive index | 1.5461 | | form | solid | | BRN | 2957579 | | InChI | InChI=1S/C28H32O4Si4/c1-33(25-17-9-5-10-18-25)29-34(2,26-19-11-6-12-20-26)31-36(4,28-23-15-8-16-24-28)32-35(3,30-33)27-21-13-7-14-22-27/h5-24H,1-4H3 | | InChIKey | IRVZFACCNZRHSJ-UHFFFAOYSA-N | | SMILES | [Si]1(C)(O[Si](C)(O[Si](C)(C2=CC=CC=C2)O[Si](C)(C2=CC=CC=C2)O1)C1=CC=CC=C1)C1=CC=CC=C1 | | EPA Substance Registry System | Cyclotetrasiloxane, 2,4,6,8-tetramethyl-2,4,6,8-tetraphenyl- (77-63-4) |
| WGK Germany | 3 | | RTECS | NI6755100 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane Usage And Synthesis |
| Uses | Reactant for synthesis of ethylhydrosilicone fluids | | reaction suitability | core: silicon
reagent type: catalyst |
| | 2,4,6,8-tetramethyl-2,4,6,8-tetraphenylcyclotetrasiloxane Preparation Products And Raw materials |
|