|
|
| | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE Basic information |
| Product Name: | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE | | Synonyms: | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE;1,1,3,5,5-Pentamethyl-3-phenylpentanetrisiloxane;Einecs 241-886-0;1,1,3,5,5-pentamethyl-3-phenyltrisiloxane;1,1,3,5,5-Pentamethyl-3-phenyltrisiloxan;[(dimethyl-λ3-silanyl)oxy-methyl-phenylsilyl]oxy-dimethylsilicon;Trisiloxane, 1,1,3,5,5-pentamethyl-3-phenyl-;Pentamethylphenyl dihydrotrisiloxane IOTA 2238 | | CAS: | 17962-34-4 | | MF: | C11H22O2Si3 | | MW: | 270.55 | | EINECS: | 241-886-0 | | Product Categories: | | | Mol File: | 17962-34-4.mol |  |
| | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE Chemical Properties |
| Boiling point | 88°C 6mm | | density | 1,023 g/cm3 | | refractive index | 1.4471 | | Fp | 80℃ | | Specific Gravity | 1.023 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | InChI=1S/C11H22O2Si3/c1-14(2)12-16(5,13-15(3)4)11-9-7-6-8-10-11/h6-10,14-15H,1-5H3 | | InChIKey | YTIKDTOMMNVHBW-UHFFFAOYSA-N | | SMILES | [SiH](C)(C)O[Si](C)(C1=CC=CC=C1)O[SiH](C)C |
| | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE Usage And Synthesis |
| | 3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE Preparation Products And Raw materials |
|