- 5-Chloro-2-nitrophenol
-
- $0.00 / 1KG
-
2026-03-17
- CAS:611-07-4
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 5-Chloro-2-nitrophenol
-
- $15.00 / 1KG
-
2021-07-13
- CAS:611-07-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 5-Chloro-2-nitrophenol
-
- $15.00 / 1KG
-
2021-07-10
- CAS:611-07-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 5-Chloro-2-nitrophenol Basic information |
| Product Name: | 5-Chloro-2-nitrophenol | | Synonyms: | 5-chloro-2-nitrophenol;5-Chlor-2-nitrophenol;2-Nitro-5-chlorophenol;5-Chloro-2-nitrophenol 95+%;5-Chloro-2-nitrobenzenol;6-Nitro-3-chlorophenol;Phenol,5-chloro-2-nitro-;4-Chloro-2-hydroxynitrobenzene | | CAS: | 611-07-4 | | MF: | C6H4ClNO3 | | MW: | 173.55 | | EINECS: | 210-249-9 | | Product Categories: | | | Mol File: | 611-07-4.mol |  |
| | 5-Chloro-2-nitrophenol Chemical Properties |
| Melting point | 41°C | | Boiling point | 247.6±20.0 °C(Predicted) | | density | 1.4914 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 6.08±0.13(Predicted) | | form | solid | | color | yellow | | InChI | InChI=1S/C6H4ClNO3/c7-4-1-2-5(8(10)11)6(9)3-4/h1-3,9H | | InChIKey | MZDBQSFPAMTTIS-UHFFFAOYSA-N | | SMILES | C1(O)=CC(Cl)=CC=C1[N+]([O-])=O | | NIST Chemistry Reference | 5-Chloro-2-nitrophenol(611-07-4) | | EPA Substance Registry System | Phenol, 5-chloro-2-nitro- (611-07-4) |
| TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2921490090 |
| | 5-Chloro-2-nitrophenol Usage And Synthesis |
| Uses | 5-Chloro-2-nitrophenol is used in organic synthesis. It is the starting material for the synthesis of 7-chloro-2H-1,4-benzoxazin-3(4H)-one. |
| | 5-Chloro-2-nitrophenol Preparation Products And Raw materials |
|