- 2-(4-Bromophenyl)naphthalene
-
- $0.00 / 1kg
-
2026-01-20
- CAS:22082-99-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1kg, 5kg, 10kg, 50kg, 100kg, 1000kg
|
| | 2-(4-Bromophenyl)naphthalene Basic information |
| Product Name: | 2-(4-Bromophenyl)naphthalene | | Synonyms: | 2-(4-Bromophenyl)naphthalene;2-(4-BroMophenyl)-naphthlene;Naphthalene, 2-(4-bromophenyl)-;2-(4-Bromophenylh)naphthalene;2-(4-Bromophenyl)naphthalen;2-(4-Bromophenyl)naphthalene >2-(4-Bromophenyl)naphthalene ISO 9001:2015 REACH;Naphthalene, 2-(4-bromopheny)- | | CAS: | 22082-99-1 | | MF: | C16H11Br | | MW: | 283.16 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 22082-99-1.mol |  |
| | 2-(4-Bromophenyl)naphthalene Chemical Properties |
| Melting point | 131.0 to 135.0 °C | | Boiling point | 394.3±11.0 °C(Predicted) | | density | 1.381±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C16H11Br/c17-16-9-7-13(8-10-16)15-6-5-12-3-1-2-4-14(12)11-15/h1-11H | | InChIKey | SAODOTSIOILVSO-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1C1=CC=C(Br)C=C1 |
| | 2-(4-Bromophenyl)naphthalene Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2-(4-Bromophenyl)naphthalene is used in the preparation of α-Phosphonosulfonate compounds which inhibit the enzyme squalene and thereby inhibit cholesterol biosynthesis. |
| | 2-(4-Bromophenyl)naphthalene Preparation Products And Raw materials |
|