|
|
| | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose Basic information |
| Product Name: | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose | | Synonyms: | chlorobenzoyl)-2-deoxy-D-ribose;3,5-di-O-(p-chlorobenzoyl)-2-deoxy-α-D-erythro-pentofuranosyl chloride;3,5-bis[o-(p-chlorbenzoyl)]-alpha-D-ribofuranosyl chloride;[(2S,3R,5R)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate;3,5-O-Bis(p-chlorobenzoyl)-2-deoxy-α-D-ribofuranosyl chloride;1-Chloro-3,5-di-O-(4-chlorobenzoyl)-2-deoxy-a-D-ribofuranose;1-a-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose;2-Deoxy-3,5-di-O-(4-chlorobenzoyl)-alpha-D-ribofuranosyl Chloride | | CAS: | 21740-23-8 | | MF: | C19H15Cl3O5 | | MW: | 429.67 | | EINECS: | 606-827-9 | | Product Categories: | Bases & Related Reagents;Intermediates;Nucleotides | | Mol File: | 21740-23-8.mol |  |
| | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose Chemical Properties |
| Melting point | 110-118°C (dec.) | | Boiling point | 530.6±50.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Not stable in Solution | | InChI | InChI=1/C19H15Cl3O5/c20-13-5-1-11(2-6-13)18(23)25-10-16-15(9-17(22)26-16)27-19(24)12-3-7-14(21)8-4-12/h1-8,15-17H,9-10H2/t15-,16+,17-/s3 | | InChIKey | QEHCZULNFYDPPL-KIQRZSAINA-N | | SMILES | C([C@H]1O[C@H](Cl)C[C@@H]1OC(C1C=CC(Cl)=CC=1)=O)OC(C1C=CC(Cl)=CC=1)=O |&1:1,3,6,r| |
| | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose Usage And Synthesis |
| Chemical Properties | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose is White Solid | | Uses | Intermediate used in the synthesis of nucleotide analogs.Unstable in solution! | | Uses | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose is used in the synthesis of nucleotide analogs. Unstable in solution! | | Synthesis | Example 3: Preparation of 1-[3,5-di-O-(p-chlorobenzoyl)]-2-deoxy-α-D-ribofuranosyl chloride
To a 250 mL four-necked round-bottomed flask under nitrogen protection was added 1-O-methyl-3,5-di-O-(p-chlorobenzoyl)-2-deoxy-α/β-D-ribofuranose (15.94 g), glacial acetic acid (60 mL), anhydrous chloroform (30 mL), anhydrous dioxane (30 mL) and acetyl chloride (0.87 g). Under stirring conditions, gaseous HCl (11.5 g) was slowly passed while the reaction temperature was controlled between 13 and 15 °C. During this process, 1-[3,5-di-O-(p-chlorobenzoyl)]-2-deoxy-α-D-ribofuranosyl chloride was gradually crystallized and precipitated.After the completion of HCl passage, the reaction mixture was continued to be stirred at 12 °C for 20 min. Subsequently, the product was collected by filtration and washed with anhydrous hexane (20 mL). After drying, 12.4 g of the target compound 1-[3,5-di-O-(p-chlorobenzoyl)]-2-deoxy-α-D-ribofuranosyl chloride was obtained as a white powder in 77% yield. | | References | [1] Patent: US2010/249394, 2010, A1. Location in patent: Page/Page column 4-5 |
| | 1-Chloro-3,5-di-(4-chlorobenzoyl)-2-deoxy-D-ribose Preparation Products And Raw materials |
|