| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-O-Methyl-2-deoxy-D-ribose Basic information |
| | 1-O-Methyl-2-deoxy-D-ribose Chemical Properties |
| Boiling point | 294.5±40.0 °C(Predicted) | | density | 1.224 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.47(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethanol (Sparingly), Methanol (Slightly), Water (Slightly) | | form | liquid | | pka | 13.81±0.60(Predicted) | | color | Colorless | | Stability: | Hygroscopic | | InChI | 1S/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5+,6/m0/s1 | | InChIKey | NVGJZDFWPSOTHM-YRZWDFBDSA-N | | SMILES | COC1C[C@H](O)[C@@H](CO)O1 | | CAS DataBase Reference | 60134-26-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 10 - Combustible liquids |
| | 1-O-Methyl-2-deoxy-D-ribose Usage And Synthesis |
| Chemical Properties | Golden Gummy Solid | | Uses | Methyl 2-Deoxy-D-ribofuranoside (cas# 60134-26-1) is a compound useful in organic synthesis. |
| | 1-O-Methyl-2-deoxy-D-ribose Preparation Products And Raw materials |
|