|
|
| | Ethyl 2,7,8-trimethylquinoline-3-carboxylate Basic information |
| Product Name: | Ethyl 2,7,8-trimethylquinoline-3-carboxylate | | Synonyms: | 2,7,8-Trimethyl-3-quinolinecarboxylic acid ethyl ester;Ethyl 2,7,8-trimethylquinoline-3-carboxylate;3-Quinolinecarboxylic acid, 2,7,8-trimethyl-, ethyl ester | | CAS: | 892874-89-4 | | MF: | C15H17NO2 | | MW: | 243.3 | | EINECS: | | | Product Categories: | | | Mol File: | 892874-89-4.mol |  |
| | Ethyl 2,7,8-trimethylquinoline-3-carboxylate Chemical Properties |
| Boiling point | 347.8±37.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | pka | 4.58±0.50(Predicted) | | form | solid | | InChI | 1S/C15H17NO2/c1-5-18-15(17)13-8-12-7-6-9(2)10(3)14(12)16-11(13)4/h6-8H,5H2,1-4H3 | | InChIKey | UHUXLFRXMAMRHH-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc2ccc(C)c(C)c2nc1C |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | Ethyl 2,7,8-trimethylquinoline-3-carboxylate Usage And Synthesis |
| | Ethyl 2,7,8-trimethylquinoline-3-carboxylate Preparation Products And Raw materials |
|