|
|
| | 2,7,8-Trimetilquinoline-3-carboxylic acid Basic information |
| | 2,7,8-Trimetilquinoline-3-carboxylic acid Chemical Properties |
| form | powder | | color | Light yellow | | InChI | 1S/C13H13NO2/c1-7-4-5-10-6-11(13(15)16)9(3)14-12(10)8(7)2/h4-6H,1-3H3,(H,15,16) | | InChIKey | KNGACCJHYQQKRJ-UHFFFAOYSA-N | | SMILES | Cc1ccc2cc(C(O)=O)c(C)nc2c1C |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2,7,8-Trimetilquinoline-3-carboxylic acid Usage And Synthesis |
| | 2,7,8-Trimetilquinoline-3-carboxylic acid Preparation Products And Raw materials |
|