|
|
| | 2-Chloro-6-mercaptobenzoic acid Basic information |
| Product Name: | 2-Chloro-6-mercaptobenzoic acid | | Synonyms: | 2-Chloro-6-mercaptobenzoic acid;Benzoic acid, 2-chloro-6-Mercapto-;6-Chloro-2-mercaptobenzoic acid;2-Mercapto-6-Chloro Benzoic Acid;8. 2-Chloro-6-sulfonylbenzoic acid - | | CAS: | 20324-51-0 | | MF: | C7H5ClO2S | | MW: | 188.63 | | EINECS: | 1312995-182-4 | | Product Categories: | OLED | | Mol File: | 20324-51-0.mol |  |
| | 2-Chloro-6-mercaptobenzoic acid Chemical Properties |
| Boiling point | 323.2±27.0 °C(Predicted) | | density | 1.490 | | pka | 2.35±0.36(Predicted) | | InChI | InChI=1S/C7H5ClO2S/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,11H,(H,9,10) | | InChIKey | AQKPOJRMYFQSLX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(S)C=CC=C1Cl |
| | 2-Chloro-6-mercaptobenzoic acid Usage And Synthesis |
| Uses | 2-Chloro-6-mercaptobenzoic Acid is a useful research chemical used in the preparation and synthesis of acetophenone oxime esters of pyrithiobac as potential herbicides. |
| | 2-Chloro-6-mercaptobenzoic acid Preparation Products And Raw materials |
|