- 3-MERCAPTOBENZOIC ACID
-
- $30.00 / 1KG
-
2025-12-12
- CAS:4869-59-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | 3-MERCAPTOBENZOIC ACID Basic information |
| | 3-MERCAPTOBENZOIC ACID Chemical Properties |
| Melting point | 144-147 °C (lit.) | | Boiling point | 322.7±25.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Ether,Alcohol | | form | powder to crystal | | pka | 3.95±0.10(Predicted) | | color | White to Light yellow to Light orange | | Stability: | Sensitive to Oxidation in Air | | InChI | InChI=1S/C7H6O2S/c8-7(9)5-2-1-3-6(10)4-5/h1-4,10H,(H,8,9) | | InChIKey | RSFDFESMVAIVKO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(S)=C1 | | CAS DataBase Reference | 4869-59-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 37/38-41-36/37/38 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3-MERCAPTOBENZOIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | An aromatic thiol compound reducing agent hair cosmetic |
| | 3-MERCAPTOBENZOIC ACID Preparation Products And Raw materials |
|