| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | NORFLUOXETINE OXALATE Basic information |
| Product Name: | NORFLUOXETINE OXALATE | | Synonyms: | NORFLUOXETINE OXALATE;gamma-[4-(Trifluoromethyl)phenoxy]benzenepropanamine ethanedioate (1:1);Norfluoxetine oxalate solution;Norfluoxetine (oxalate) (CRM);Norfluoxetine Oxalate 1.0 mg/ml in Methanol (as free base) | | CAS: | 107674-50-0 | | MF: | C18H18F3NO5 | | MW: | 385.34 | | EINECS: | | | Product Categories: | | | Mol File: | 107674-50-0.mol |  |
| | NORFLUOXETINE OXALATE Chemical Properties |
| Fp | 9℃ | | storage temp. | 2-8°C | | form | liquid | | Major Application | clinical testing | | InChI | 1S/C16H16F3NO.C2H2O4/c17-16(18,19)13-6-8-14(9-7-13)21-15(10-11-20)12-4-2-1-3-5-12;3-1(4)2(5)6/h1-9,15H,10-11,20H2;(H,3,4)(H,5,6) | | InChIKey | FDWJCEPFCGIDPF-UHFFFAOYSA-N | | SMILES | NCCC(C1=CC=CC=C1)OC2=CC=C(C(F)(F)F)C=C2.OC(C(O)=O)=O | | EPA Substance Registry System | Benzenepropanamine, .gamma.-[4-(trifluoromethyl)phenoxy]-, ethanedioate (1:1) (107674-50-0) |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | NORFLUOXETINE OXALATE Usage And Synthesis |
| Uses | clinical testing | | General Description | Norfluoxetine is a primary blood metabolite of the selective serotonin reuptake inhibitor (SSRI) fluoxetine, an antidepressant, sold under the trade name Prozac. This Snap-N-Spike Reference Solution is applicable to use in urine drug testing, clinical toxicology, or forensic analysis by LC-MS/MS or GC/MS. |
| | NORFLUOXETINE OXALATE Preparation Products And Raw materials |
|