trans-4-tert-Butylcyclohexanol manufacturers
|
| | trans-4-tert-Butylcyclohexanol Basic information |
| Product Name: | trans-4-tert-Butylcyclohexanol | | Synonyms: | Nano Liposomal 1-Dimethylethyl-4-trans-cyclohexano;Butylcyclohexanol;(1α,4β)-4-tert-Butylcyclohexan-1-ol;trans-4-tert-Butylcyclohexanol;1-dimethylethyl)-4-(trans-cyclohexano;trans-4-tert-Butylcyclohexanol >;trans-4-tert-ButyL;Cyclohexanol, 4-(1,1-dimethylethyl)-, trans- | | CAS: | 21862-63-5 | | MF: | C10H20O | | MW: | 156.27 | | EINECS: | 700-127-8 | | Product Categories: | | | Mol File: | 21862-63-5.mol |  |
| | trans-4-tert-Butylcyclohexanol Chemical Properties |
| Melting point | 80 °C | | Boiling point | 230.54°C (estimate) | | density | 0.9052 (estimate) | | vapor pressure | 0.74-29Pa at 20-50℃ | | refractive index | 1.4583 (estimate) | | FEMA | 4724 | TRANS-4-TERT-BUTYLCYCLOHEXANOL | | storage temp. | Store at room temperature | | pka | 15.32±0.40(Predicted) | | form | Solid:flakes | | Odor | at 10.00 % in dipropylene glycol. woody patchouli | | Appearance | White to off-white Solid | | Odor Type | woody | | JECFA Number | 2263 | | InChI | InChI=1S/C10H20O/c1-10(2,3)8-4-6-9(11)7-5-8/h8-9,11H,4-7H2,1-3H3/t8-,9- | | InChIKey | CCOQPGVQAWPUPE-KYZUINATSA-N | | SMILES | [C@@H]1(O)CC[C@@H](C(C)(C)C)CC1 | | LogP | 3.42 at 25℃ | | EPA Substance Registry System | Cyclohexanol, 4-(1,1-dimethylethyl)-, trans- (21862-63-5) |
| | trans-4-tert-Butylcyclohexanol Usage And Synthesis |
| Chemical Properties | trans-4-tert-Butylcyclohexanol is a white crystals, insoluble in water, soluble in alcohol. At 10.00 % in dipropylene glycol. woody patchouli. | | Uses | trans-4-tert-Butylcyclohexanol is used as a reaction reagent and an intermediate in organic synthesis, mainly in chemical manufacturing or experimental research. |
| | trans-4-tert-Butylcyclohexanol Preparation Products And Raw materials |
|