2,6-Dimethyl-pyridine-4-boronic acid manufacturers
|
| | 2,6-Dimethyl-pyridine-4-boronic acid Basic information |
| Product Name: | 2,6-Dimethyl-pyridine-4-boronic acid | | Synonyms: | 2,6-Dimethyl-pyridine-4-boronic acid;2,6-diMethylpyridin-4-yl-4-boronic acid;B-(2,6-dimethyl-4-pyridinyl)-Boronic acid;Boronic acid, B-(2,6-dimethyl-4-pyridinyl)-;(2,6-Dimethylpyridin-4-yl);6-diMethylpyridin-4-yl-4-boronic acid;2,6-Dimethylpyridin-4-boronic acid;(2,6-dimethylpyridin-4-yl)boronic acid - [D25621] | | CAS: | 846548-44-5 | | MF: | C7H10BNO2 | | MW: | 150.97 | | EINECS: | 200-528-9 | | Product Categories: | | | Mol File: | 846548-44-5.mol |  |
| | 2,6-Dimethyl-pyridine-4-boronic acid Chemical Properties |
| Boiling point | 316.9±52.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 7.72±0.11(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H10BNO2/c1-5-3-7(8(10)11)4-6(2)9-5/h3-4,10-11H,1-2H3 | | InChIKey | ALGDKINLACWIRM-UHFFFAOYSA-N | | SMILES | B(C1C=C(C)N=C(C)C=1)(O)O |
| | 2,6-Dimethyl-pyridine-4-boronic acid Usage And Synthesis |
| Uses | 2,6-Dimethyl-4-pyridylboronic Acid is used to synthesize isothiazolopyridones with antibacterial activity. | | Synthesis | The general procedure for the synthesis of 2,6-dimethyl-pyridine-4-boronic acid from 4-bromo-2,6-dimethylpyridine and triisopropyl borate was as follows: in a dry reaction flask, 4-bromo-2,6-dimethylpyridine (100 mg, 0.54 mmol) and triisopropyl borate (149 μL, 0.65 mmol) were dissolved in anhydrous THF (5 mL). The reaction system was cooled to -78 °C under nitrogen protection, followed by the slow dropwise addition of a hexane solution of 2.5 M n-BuLi (0.26 mL, 0.65 mmol). After the dropwise addition, the reaction was kept at -78 °C for 30 min. Subsequently, the reaction mixture was slowly warmed to room temperature and stirring was continued for 1 hour. After completion of the reaction, 1 N HCl (5 mL) was added to the reaction system and stirred for 30 min at room temperature. Next, the reaction solution was adjusted to alkaline (pH ~9) with 1 N NaOH and then extracted with EtOAc (3 × 10 mL). The organic phases were combined, dried with anhydrous Na2SO4, filtered and concentrated under reduced pressure to afford 2,6-dimethyl-pyridine-4-boronic acid (30.0 mg, 0.20 mmol, 37% yield) as a white solid. | | References | [1] Patent: WO2016/196644, 2016, A1. Location in patent: Paragraph 243; 244
[2] Patent: WO2018/102452, 2018, A2. Location in patent: Paragraph 227; 228 |
| | 2,6-Dimethyl-pyridine-4-boronic acid Preparation Products And Raw materials |
|