2-Bromophenacyl bromide manufacturers
|
| | 2-Bromophenacyl bromide Basic information |
| Product Name: | 2-Bromophenacyl bromide | | Synonyms: | 2,2'-dibromoacetophenone;2-Bromo-2'-bromoacetophenone;2-Bromophenacylbromide90%;2-Bromophenacylbromide97%;2-Bromophenacyl bromide;2-Bromo-1-(2-bromophenyl)ethan-1-one, 2,2'-Dibromoacetophenone;2-Bromophenacyl Bromide >Ethanone, 2-bromo-1-(2-bromophenyl)- | | CAS: | 49851-55-0 | | MF: | C8H6Br2O | | MW: | 277.94 | | EINECS: | | | Product Categories: | | | Mol File: | 49851-55-0.mol |  |
| | 2-Bromophenacyl bromide Chemical Properties |
| Boiling point | 90-92°C/0.02mm | | density | 1.848±0.06 g/cm3(Predicted) | | refractive index | 1.6100-1.6140 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Sensitive | Lachrymatory | | InChI | InChI=1S/C8H6Br2O/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4H,5H2 | | InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC=C1Br)CBr |
| Hazard Codes | C | | RIDADR | 3261 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2914790090 |
| | 2-Bromophenacyl bromide Usage And Synthesis |
| Uses | 2,2''-Dibromoacetophenone is used in the preparation of 4-phenylthiazol-2(3H)-one derivatives as anticonvulsant agents. |
| | 2-Bromophenacyl bromide Preparation Products And Raw materials |
|